C20H21FN2O2 — CID 3484461
3-(4-aminobutyl)-2-(4-fluorophenyl)-7-methyl-1H-indole-4-carboxylic acid (PubChem CID 3484461) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(4-fluorophenyl)-7-methyl-1H-indole-4-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-2-(4-fluorophenyl)-7-methyl-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 3484461 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-(4-aminobutyl)-2-(4-fluorophenyl)-7-methyl-1H-indole-4-carboxylic acid |
| SMILES | Cc1ccc(C(=O)O)c2c(CCCCN)c(-c3ccc(F)cc3)[nH]c12 |
| InChI | InChI=1S/C20H21FN2O2/c1-12-5-10-16(20(24)25)17-15(4-2-3-11-22)19(23-18(12)17)13-6-8-14(21)9-7-13/h5-10,23H,2-4,11,22H2,1H3,(H,24,25) |
| InChIKey | FMODQHGSZQCWET-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|