C26H24N2O2S — CID 3458963
3-(4-aminobutyl)-2-dibenzothiophen-2-yl-7-methyl-1H-indole-4-carboxylic acid (PubChem CID 3458963) has the molecular formula C26H24N2O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-dibenzothiophen-2-yl-7-methyl-1H-indole-4-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-2-dibenzothiophen-2-yl-7-methyl-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 3458963 |
| Molecular Formula | C26H24N2O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-(4-aminobutyl)-2-dibenzothiophen-2-yl-7-methyl-1H-indole-4-carboxylic acid |
| SMILES | Cc1ccc(C(=O)O)c2c(CCCCN)c(-c3ccc4sc5ccccc5c4c3)[nH]c12 |
| InChI | InChI=1S/C26H24N2O2S/c1-15-9-11-19(26(29)30)23-18(7-4-5-13-27)25(28-24(15)23)16-10-12-22-20(14-16)17-6-2-3-8-21(17)31-22/h2-3,6,8-12,14,28H,4-5,7,13,27H2,1H3,(H,29,30) |
| InChIKey | FMNLXKHSFKMCKS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|