C27H28N2S — CID 3396019
4-(2-dibenzothiophen-2-yl-7-propan-2-yl-1H-indol-3-yl)butan-1-amine (PubChem CID 3396019) has the molecular formula C27H28N2S and a molecular weight of 412.60 g/mol. Its IUPAC name is 4-(2-dibenzothiophen-2-yl-7-propan-2-yl-1H-indol-3-yl)butan-1-amine.
| Compound Name | 4-(2-dibenzothiophen-2-yl-7-propan-2-yl-1H-indol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 3396019 |
| Molecular Formula | C27H28N2S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 4-(2-dibenzothiophen-2-yl-7-propan-2-yl-1H-indol-3-yl)butan-1-amine |
| SMILES | CC(C)c1cccc2c(CCCCN)c(-c3ccc4sc5ccccc5c4c3)[nH]c12 |
| InChI | InChI=1S/C27H28N2S/c1-17(2)19-10-7-11-22-21(9-5-6-15-28)26(29-27(19)22)18-13-14-25-23(16-18)20-8-3-4-12-24(20)30-25/h3-4,7-8,10-14,16-17,29H,5-6,9,15,28H2,1-2H3 |
| InChIKey | NAMFBPMTQAFNLF-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|