C20H19FN2S — CID 4537398
4-[2-(1-benzothiophen-3-yl)-7-fluoro-1H-indol-3-yl]butan-1-amine (PubChem CID 4537398) has the molecular formula C20H19FN2S and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-[2-(1-benzothiophen-3-yl)-7-fluoro-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(1-benzothiophen-3-yl)-7-fluoro-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4537398 |
| Molecular Formula | C20H19FN2S |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-[2-(1-benzothiophen-3-yl)-7-fluoro-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2csc3ccccc23)[nH]c2c(F)cccc12 |
| InChI | InChI=1S/C20H19FN2S/c21-17-9-5-8-15-14(7-3-4-11-22)19(23-20(15)17)16-12-24-18-10-2-1-6-13(16)18/h1-2,5-6,8-10,12,23H,3-4,7,11,22H2 |
| InChIKey | NKYXCDKJZHFNJZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|