C18H20FN3 — CID 3397207
4-[7-fluoro-2-(5-methyl-2-pyridinyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3397207) has the molecular formula C18H20FN3 and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-[7-fluoro-2-(5-methyl-2-pyridinyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[7-fluoro-2-(5-methyl-2-pyridinyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3397207 |
| Molecular Formula | C18H20FN3 |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 4-[7-fluoro-2-(5-methyl-2-pyridinyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc(-c2[nH]c3c(F)cccc3c2CCCCN)nc1 |
| InChI | InChI=1S/C18H20FN3/c1-12-8-9-16(21-11-12)18-14(5-2-3-10-20)13-6-4-7-15(19)17(13)22-18/h4,6-9,11,22H,2-3,5,10,20H2,1H3 |
| InChIKey | MXLLQMURCPEVFE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|