C18H17ClF2N2 — CID 4532381
4-[2-(2-chloro-4-fluorophenyl)-7-fluoro-1H-indol-3-yl]butan-1-amine (PubChem CID 4532381) has the molecular formula C18H17ClF2N2 and a molecular weight of 334.80 g/mol. Its IUPAC name is 4-[2-(2-chloro-4-fluorophenyl)-7-fluoro-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(2-chloro-4-fluorophenyl)-7-fluoro-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4532381 |
| Molecular Formula | C18H17ClF2N2 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-[2-(2-chloro-4-fluorophenyl)-7-fluoro-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccc(F)cc2Cl)[nH]c2c(F)cccc12 |
| InChI | InChI=1S/C18H17ClF2N2/c19-15-10-11(20)7-8-14(15)17-12(4-1-2-9-22)13-5-3-6-16(21)18(13)23-17/h3,5-8,10,23H,1-2,4,9,22H2 |
| InChIKey | JUSCWZGRJNSTIH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|