C22H20Cl2N2 — CID 3936091
4-[2-(2,4-dichlorophenyl)-1H-benzo[g]indol-3-yl]butan-1-amine (PubChem CID 3936091) has the molecular formula C22H20Cl2N2 and a molecular weight of 383.32 g/mol. Its IUPAC name is 4-[2-(2,4-dichlorophenyl)-1H-benzo[g]indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(2,4-dichlorophenyl)-1H-benzo[g]indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3936091 |
| Molecular Formula | C22H20Cl2N2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-[2-(2,4-dichlorophenyl)-1H-benzo[g]indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccc(Cl)cc2Cl)[nH]c2c1ccc1ccccc12 |
| InChI | InChI=1S/C22H20Cl2N2/c23-15-9-11-19(20(24)13-15)22-17(7-3-4-12-25)18-10-8-14-5-1-2-6-16(14)21(18)26-22/h1-2,5-6,8-11,13,26H,3-4,7,12,25H2 |
| InChIKey | IWLWEKGFNHNEKJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|