About 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile
3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile (PubChem CID 4022395) has the molecular formula C19H17Cl2N3
and a molecular weight of 358.27 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile |
| PubChem CID | 4022395 |
| Molecular Formula | C19H17Cl2N3 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]c(-c3ccc(Cl)cc3Cl)c(CCCCN)c2c1 |
| InChI | InChI=1S/C19H17Cl2N3/c20-13-5-6-15(17(21)10-13)19-14(3-1-2-8-22)16-9-12(11-23)4-7-18(16)24-19/h4-7,9-10,24H,1-3,8,22H2 |
| InChIKey | CYOOEJUJXREYAG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile?
The IUPAC name of 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile (CID 4022395) is 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile.
What is the SMILES notation for 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile?
The canonical SMILES for 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile is N#Cc1ccc2[nH]c(-c3ccc(Cl)cc3Cl)c(CCCCN)c2c1.
What is the InChIKey of 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile?
The InChIKey is CYOOEJUJXREYAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Cl2N3/c20-13-5-6-15(17(21)10-13)19-14(3-1-2-8-22)16-9-12(11-23)4-7-18(16)24-19/h4-7,9-10,24H,1-3,8,22H2.
What are the key properties of 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile?
3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile has a molecular weight of 358.27 g/mol, XLogP of 5.29, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile is sourced from PubChem (CID 4022395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).