C19H17Cl2N3 — CID 4022395
3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile (PubChem CID 4022395) has the molecular formula C19H17Cl2N3 and a molecular weight of 358.27 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile.
| Compound Name | 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 4022395 |
| Molecular Formula | C19H17Cl2N3 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 3-(4-aminobutyl)-2-(2,4-dichlorophenyl)-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]c(-c3ccc(Cl)cc3Cl)c(CCCCN)c2c1 |
| InChI | InChI=1S/C19H17Cl2N3/c20-13-5-6-15(17(21)10-13)19-14(3-1-2-8-22)16-9-12(11-23)4-7-18(16)24-19/h4-7,9-10,24H,1-3,8,22H2 |
| InChIKey | CYOOEJUJXREYAG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|