About 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile
3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile (PubChem CID 4213545) has the molecular formula C21H23N3O2
and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile |
| PubChem CID | 4213545 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile |
| SMILES | COc1ccc(-c2[nH]c3ccc(C#N)cc3c2CCCCN)cc1OC |
| InChI | InChI=1S/C21H23N3O2/c1-25-19-9-7-15(12-20(19)26-2)21-16(5-3-4-10-22)17-11-14(13-23)6-8-18(17)24-21/h6-9,11-12,24H,3-5,10,22H2,1-2H3 |
| InChIKey | UWZCTVCRXRLIAF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile?
The IUPAC name of 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile (CID 4213545) is 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile.
What is the SMILES notation for 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile?
The canonical SMILES for 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile is COc1ccc(-c2[nH]c3ccc(C#N)cc3c2CCCCN)cc1OC.
What is the InChIKey of 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile?
The InChIKey is UWZCTVCRXRLIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O2/c1-25-19-9-7-15(12-20(19)26-2)21-16(5-3-4-10-22)17-11-14(13-23)6-8-18(17)24-21/h6-9,11-12,24H,3-5,10,22H2,1-2H3.
What are the key properties of 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile?
3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile has a molecular weight of 349.43 g/mol, XLogP of 4.01, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile is sourced from PubChem (CID 4213545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).