C21H23N3O2 — CID 4213545
3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile (PubChem CID 4213545) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile.
| Compound Name | 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 4213545 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-(4-aminobutyl)-2-(3,4-dimethoxyphenyl)-1H-indole-5-carbonitrile |
| SMILES | COc1ccc(-c2[nH]c3ccc(C#N)cc3c2CCCCN)cc1OC |
| InChI | InChI=1S/C21H23N3O2/c1-25-19-9-7-15(12-20(19)26-2)21-16(5-3-4-10-22)17-11-14(13-23)6-8-18(17)24-21/h6-9,11-12,24H,3-5,10,22H2,1-2H3 |
| InChIKey | UWZCTVCRXRLIAF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|