C25H34N2O3 — CID 3914756
4-[5-butyl-2-(3,4,5-trimethoxyphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3914756) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is 4-[5-butyl-2-(3,4,5-trimethoxyphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-butyl-2-(3,4,5-trimethoxyphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3914756 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 4-[5-butyl-2-(3,4,5-trimethoxyphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCCCc1ccc2[nH]c(-c3cc(OC)c(OC)c(OC)c3)c(CCCCN)c2c1 |
| InChI | InChI=1S/C25H34N2O3/c1-5-6-9-17-11-12-21-20(14-17)19(10-7-8-13-26)24(27-21)18-15-22(28-2)25(30-4)23(16-18)29-3/h11-12,14-16,27H,5-10,13,26H2,1-4H3 |
| InChIKey | IKOUCVOZAMPDEO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|