C24H28N2S — CID 4687429
4-[2-(1-benzothiophen-2-yl)-5-butyl-1H-indol-3-yl]butan-1-amine (PubChem CID 4687429) has the molecular formula C24H28N2S and a molecular weight of 376.57 g/mol. Its IUPAC name is 4-[2-(1-benzothiophen-2-yl)-5-butyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(1-benzothiophen-2-yl)-5-butyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4687429 |
| Molecular Formula | C24H28N2S |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 4-[2-(1-benzothiophen-2-yl)-5-butyl-1H-indol-3-yl]butan-1-amine |
| SMILES | CCCCc1ccc2[nH]c(-c3cc4ccccc4s3)c(CCCCN)c2c1 |
| InChI | InChI=1S/C24H28N2S/c1-2-3-8-17-12-13-21-20(15-17)19(10-6-7-14-25)24(26-21)23-16-18-9-4-5-11-22(18)27-23/h4-5,9,11-13,15-16,26H,2-3,6-8,10,14,25H2,1H3 |
| InChIKey | KUJCGQJJSRNRST-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|