C21H22N2S — CID 3879590
4-[2-(1-benzothiophen-2-yl)-7-methyl-1H-indol-3-yl]butan-1-amine (PubChem CID 3879590) has the molecular formula C21H22N2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 4-[2-(1-benzothiophen-2-yl)-7-methyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(1-benzothiophen-2-yl)-7-methyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3879590 |
| Molecular Formula | C21H22N2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-[2-(1-benzothiophen-2-yl)-7-methyl-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1cccc2c(CCCCN)c(-c3cc4ccccc4s3)[nH]c12 |
| InChI | InChI=1S/C21H22N2S/c1-14-7-6-10-16-17(9-4-5-12-22)21(23-20(14)16)19-13-15-8-2-3-11-18(15)24-19/h2-3,6-8,10-11,13,23H,4-5,9,12,22H2,1H3 |
| InChIKey | QDXHHIOCTGSNFV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|