C25H26N2O — CID 3895862
4-[7-methyl-2-(3-phenoxyphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3895862) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-[7-methyl-2-(3-phenoxyphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[7-methyl-2-(3-phenoxyphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3895862 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 4-[7-methyl-2-(3-phenoxyphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1cccc2c(CCCCN)c(-c3cccc(Oc4ccccc4)c3)[nH]c12 |
| InChI | InChI=1S/C25H26N2O/c1-18-9-7-15-22-23(14-5-6-16-26)25(27-24(18)22)19-10-8-13-21(17-19)28-20-11-3-2-4-12-20/h2-4,7-13,15,17,27H,5-6,14,16,26H2,1H3 |
| InChIKey | NJZOBBSLHOIIGQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|