C22H28N2O2 — CID 4566691
4-[2-(3,5-dimethoxyphenyl)-5,7-dimethyl-1H-indol-3-yl]butan-1-amine (PubChem CID 4566691) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 4-[2-(3,5-dimethoxyphenyl)-5,7-dimethyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(3,5-dimethoxyphenyl)-5,7-dimethyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4566691 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 4-[2-(3,5-dimethoxyphenyl)-5,7-dimethyl-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1cc(OC)cc(-c2[nH]c3c(C)cc(C)cc3c2CCCCN)c1 |
| InChI | InChI=1S/C22H28N2O2/c1-14-9-15(2)21-20(10-14)19(7-5-6-8-23)22(24-21)16-11-17(25-3)13-18(12-16)26-4/h9-13,24H,5-8,23H2,1-4H3 |
| InChIKey | VAVLSTSFRISBHP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|