C19H20ClFN2 — CID 3574598
4-[5-chloro-2-(4-fluorophenyl)-7-methyl-1H-indol-3-yl]butan-1-amine (PubChem CID 3574598) has the molecular formula C19H20ClFN2 and a molecular weight of 330.83 g/mol. Its IUPAC name is 4-[5-chloro-2-(4-fluorophenyl)-7-methyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-chloro-2-(4-fluorophenyl)-7-methyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3574598 |
| Molecular Formula | C19H20ClFN2 |
| Molecular Weight | 330.83 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 4-[5-chloro-2-(4-fluorophenyl)-7-methyl-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1cc(Cl)cc2c(CCCCN)c(-c3ccc(F)cc3)[nH]c12 |
| InChI | InChI=1S/C19H20ClFN2/c1-12-10-14(20)11-17-16(4-2-3-9-22)19(23-18(12)17)13-5-7-15(21)8-6-13/h5-8,10-11,23H,2-4,9,22H2,1H3 |
| InChIKey | WMUSNQJLFDFVDW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.83 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|