C21H22ClF3N2 — CID 3500746
4-[5-chloro-2-(4-ethylphenyl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3500746) has the molecular formula C21H22ClF3N2 and a molecular weight of 394.87 g/mol. Its IUPAC name is 4-[5-chloro-2-(4-ethylphenyl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-chloro-2-(4-ethylphenyl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3500746 |
| Molecular Formula | C21H22ClF3N2 |
| Molecular Weight | 394.87 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 4-[5-chloro-2-(4-ethylphenyl)-7-(trifluoromethyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCc1ccc(-c2[nH]c3c(C(F)(F)F)cc(Cl)cc3c2CCCCN)cc1 |
| InChI | InChI=1S/C21H22ClF3N2/c1-2-13-6-8-14(9-7-13)19-16(5-3-4-10-26)17-11-15(22)12-18(20(17)27-19)21(23,24)25/h6-9,11-12,27H,2-5,10,26H2,1H3 |
| InChIKey | IOQJXCDBVDJXST-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.87 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|