C22H28N2 — CID 5034856
4-[7-ethyl-2-(4-ethylphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 5034856) has the molecular formula C22H28N2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 4-[7-ethyl-2-(4-ethylphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[7-ethyl-2-(4-ethylphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 5034856 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 4-[7-ethyl-2-(4-ethylphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCc1ccc(-c2[nH]c3c(CC)cccc3c2CCCCN)cc1 |
| InChI | InChI=1S/C22H28N2/c1-3-16-11-13-18(14-12-16)22-19(9-5-6-15-23)20-10-7-8-17(4-2)21(20)24-22/h7-8,10-14,24H,3-6,9,15,23H2,1-2H3 |
| InChIKey | NRPQFCDNEVIIHD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|