C22H26N4 — CID 4275710
4-[7-ethyl-2-(1-methylbenzimidazol-2-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4275710) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is 4-[7-ethyl-2-(1-methylbenzimidazol-2-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[7-ethyl-2-(1-methylbenzimidazol-2-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4275710 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 4-[7-ethyl-2-(1-methylbenzimidazol-2-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCc1cccc2c(CCCCN)c(-c3nc4ccccc4n3C)[nH]c12 |
| InChI | InChI=1S/C22H26N4/c1-3-15-9-8-11-16-17(10-6-7-14-23)21(25-20(15)16)22-24-18-12-4-5-13-19(18)26(22)2/h4-5,8-9,11-13,25H,3,6-7,10,14,23H2,1-2H3 |
| InChIKey | GIUDEUBAVYDYTR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|