C30H36N4 — CID 3681691
4-[5-(1-adamantyl)-2-(1-methylbenzimidazol-2-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3681691) has the molecular formula C30H36N4 and a molecular weight of 452.65 g/mol. Its IUPAC name is 4-[5-(1-adamantyl)-2-(1-methylbenzimidazol-2-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-(1-adamantyl)-2-(1-methylbenzimidazol-2-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3681691 |
| Molecular Formula | C30H36N4 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 4-[5-(1-adamantyl)-2-(1-methylbenzimidazol-2-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | Cn1c(-c2[nH]c3ccc(C45CC6CC(CC(C6)C4)C5)cc3c2CCCCN)nc2ccccc21 |
| InChI | InChI=1S/C30H36N4/c1-34-27-8-3-2-7-26(27)33-29(34)28-23(6-4-5-11-31)24-15-22(9-10-25(24)32-28)30-16-19-12-20(17-30)14-21(13-19)18-30/h2-3,7-10,15,19-21,32H,4-6,11-14,16-18,31H2,1H3 |
| InChIKey | CTQGXCWZODJTTQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|