C22H22ClN3 — CID 3577273
4-[5-chloro-2-(2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3577273) has the molecular formula C22H22ClN3 and a molecular weight of 363.89 g/mol. Its IUPAC name is 4-[5-chloro-2-(2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-chloro-2-(2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3577273 |
| Molecular Formula | C22H22ClN3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 4-[5-chloro-2-(2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc2c(-c3[nH]c4ccc(Cl)cc4c3CCCCN)cccc2n1 |
| InChI | InChI=1S/C22H22ClN3/c1-14-8-10-16-17(6-4-7-20(16)25-14)22-18(5-2-3-12-24)19-13-15(23)9-11-21(19)26-22/h4,6-11,13,26H,2-3,5,12,24H2,1H3 |
| InChIKey | FAPFBDBYCHOBAE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|