C24H23FN2 — CID 4027468
4-[5-fluoro-2-(2-phenylphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4027468) has the molecular formula C24H23FN2 and a molecular weight of 358.46 g/mol. Its IUPAC name is 4-[5-fluoro-2-(2-phenylphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-fluoro-2-(2-phenylphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4027468 |
| Molecular Formula | C24H23FN2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 4-[5-fluoro-2-(2-phenylphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccccc2-c2ccccc2)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C24H23FN2/c25-18-13-14-23-22(16-18)21(12-6-7-15-26)24(27-23)20-11-5-4-10-19(20)17-8-2-1-3-9-17/h1-5,8-11,13-14,16,27H,6-7,12,15,26H2 |
| InChIKey | QJYBXZQBULJEIX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|