C26H28N2O — CID 4545221
4-[2-(2-methoxy-3-methylphenyl)-5-phenyl-1H-indol-3-yl]butan-1-amine (PubChem CID 4545221) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is 4-[2-(2-methoxy-3-methylphenyl)-5-phenyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(2-methoxy-3-methylphenyl)-5-phenyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4545221 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 4-[2-(2-methoxy-3-methylphenyl)-5-phenyl-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1c(C)cccc1-c1[nH]c2ccc(-c3ccccc3)cc2c1CCCCN |
| InChI | InChI=1S/C26H28N2O/c1-18-9-8-13-22(26(18)29-2)25-21(12-6-7-16-27)23-17-20(14-15-24(23)28-25)19-10-4-3-5-11-19/h3-5,8-11,13-15,17,28H,6-7,12,16,27H2,1-2H3 |
| InChIKey | IICBIINKPFLOHC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|