C20H22Cl2N2O — CID 4222400
4-[5,7-dichloro-2-(2-methoxy-3-methylphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4222400) has the molecular formula C20H22Cl2N2O and a molecular weight of 377.32 g/mol. Its IUPAC name is 4-[5,7-dichloro-2-(2-methoxy-3-methylphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5,7-dichloro-2-(2-methoxy-3-methylphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4222400 |
| Molecular Formula | C20H22Cl2N2O |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-[5,7-dichloro-2-(2-methoxy-3-methylphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1c(C)cccc1-c1[nH]c2c(Cl)cc(Cl)cc2c1CCCCN |
| InChI | InChI=1S/C20H22Cl2N2O/c1-12-6-5-8-15(20(12)25-2)18-14(7-3-4-9-23)16-10-13(21)11-17(22)19(16)24-18/h5-6,8,10-11,24H,3-4,7,9,23H2,1-2H3 |
| InChIKey | BWTPWOHLMGTIQM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|