C24H32N2O — CID 3933978
4-[7-butan-2-yl-2-(2-methoxy-3-methylphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3933978) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 4-[7-butan-2-yl-2-(2-methoxy-3-methylphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[7-butan-2-yl-2-(2-methoxy-3-methylphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3933978 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 4-[7-butan-2-yl-2-(2-methoxy-3-methylphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCC(C)c1cccc2c(CCCCN)c(-c3cccc(C)c3OC)[nH]c12 |
| InChI | InChI=1S/C24H32N2O/c1-5-16(2)18-12-9-13-20-19(11-6-7-15-25)23(26-22(18)20)21-14-8-10-17(3)24(21)27-4/h8-10,12-14,16,26H,5-7,11,15,25H2,1-4H3 |
| InChIKey | KLWJGHOXBRSINO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|