About 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine
4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine (PubChem CID 3902538) has the molecular formula C22H28N2O
and a molecular weight of 336.48 g/mol. Its IUPAC name is 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine.
Molecular Properties
| Compound Name | 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine |
| PubChem CID | 3902538 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine |
| SMILES | CCOc1ccccc1-c1[nH]c2c(C)c(C)ccc2c1CCCCN |
| InChI | InChI=1S/C22H28N2O/c1-4-25-20-11-6-5-10-19(20)22-17(9-7-8-14-23)18-13-12-15(2)16(3)21(18)24-22/h5-6,10-13,24H,4,7-9,14,23H2,1-3H3 |
| InChIKey | RNLVVGYUBNDZNR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine?
The IUPAC name of 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine (CID 3902538) is 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine.
What is the SMILES notation for 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine?
The canonical SMILES for 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine is CCOc1ccccc1-c1[nH]c2c(C)c(C)ccc2c1CCCCN.
What is the InChIKey of 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine?
The InChIKey is RNLVVGYUBNDZNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O/c1-4-25-20-11-6-5-10-19(20)22-17(9-7-8-14-23)18-13-12-15(2)16(3)21(18)24-22/h5-6,10-13,24H,4,7-9,14,23H2,1-3H3.
What are the key properties of 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine?
4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine has a molecular weight of 336.48 g/mol, XLogP of 5.13, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine is sourced from PubChem (CID 3902538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).