C22H28N2O — CID 3902538
4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine (PubChem CID 3902538) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3902538 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 4-[2-(2-ethoxyphenyl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine |
| SMILES | CCOc1ccccc1-c1[nH]c2c(C)c(C)ccc2c1CCCCN |
| InChI | InChI=1S/C22H28N2O/c1-4-25-20-11-6-5-10-19(20)22-17(9-7-8-14-23)18-13-12-15(2)16(3)21(18)24-22/h5-6,10-13,24H,4,7-9,14,23H2,1-3H3 |
| InChIKey | RNLVVGYUBNDZNR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|