C21H24N2O2 — CID 4017312
4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine (PubChem CID 4017312) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4017312 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc2c(CCCCN)c(-c3ccc4c(c3)OCO4)[nH]c2c1C |
| InChI | InChI=1S/C21H24N2O2/c1-13-6-8-17-16(5-3-4-10-22)21(23-20(17)14(13)2)15-7-9-18-19(11-15)25-12-24-18/h6-9,11,23H,3-5,10,12,22H2,1-2H3 |
| InChIKey | XTXHFUPATWZJPO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|