About 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine
4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine (PubChem CID 4017312) has the molecular formula C21H24N2O2
and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine.
Molecular Properties
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine |
| PubChem CID | 4017312 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc2c(CCCCN)c(-c3ccc4c(c3)OCO4)[nH]c2c1C |
| InChI | InChI=1S/C21H24N2O2/c1-13-6-8-17-16(5-3-4-10-22)21(23-20(17)14(13)2)15-7-9-18-19(11-15)25-12-24-18/h6-9,11,23H,3-5,10,12,22H2,1-2H3 |
| InChIKey | XTXHFUPATWZJPO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine?
The IUPAC name of 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine (CID 4017312) is 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine.
What is the SMILES notation for 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine?
The canonical SMILES for 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine is Cc1ccc2c(CCCCN)c(-c3ccc4c(c3)OCO4)[nH]c2c1C.
What is the InChIKey of 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine?
The InChIKey is XTXHFUPATWZJPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O2/c1-13-6-8-17-16(5-3-4-10-22)21(23-20(17)14(13)2)15-7-9-18-19(11-15)25-12-24-18/h6-9,11,23H,3-5,10,12,22H2,1-2H3.
What are the key properties of 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine?
4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine has a molecular weight of 336.44 g/mol, XLogP of 4.46, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-benzodioxol-5-yl)-6,7-dimethyl-1H-indol-3-yl]butan-1-amine is sourced from PubChem (CID 4017312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).