C19H17NO4 — CID 3924560
2-[2-(1,3-benzodioxol-5-yl)-4,7-dimethyl-1H-indol-3-yl]acetic acid (PubChem CID 3924560) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-4,7-dimethyl-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)-4,7-dimethyl-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 3924560 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)-4,7-dimethyl-1H-indol-3-yl]acetic acid |
| SMILES | Cc1ccc(C)c2c(CC(=O)O)c(-c3ccc4c(c3)OCO4)[nH]c12 |
| InChI | InChI=1S/C19H17NO4/c1-10-3-4-11(2)18-17(10)13(8-16(21)22)19(20-18)12-5-6-14-15(7-12)24-9-23-14/h3-7,20H,8-9H2,1-2H3,(H,21,22) |
| InChIKey | CNUNQWYHXQMXJC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |