C17H13BrClNO2 — CID 5203529
2-[2-(4-bromophenyl)-4-chloro-7-methyl-1H-indol-3-yl]acetic acid (PubChem CID 5203529) has the molecular formula C17H13BrClNO2 and a molecular weight of 378.65 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-4-chloro-7-methyl-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-(4-bromophenyl)-4-chloro-7-methyl-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 5203529 |
| Molecular Formula | C17H13BrClNO2 |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 2-[2-(4-bromophenyl)-4-chloro-7-methyl-1H-indol-3-yl]acetic acid |
| SMILES | Cc1ccc(Cl)c2c(CC(=O)O)c(-c3ccc(Br)cc3)[nH]c12 |
| InChI | InChI=1S/C17H13BrClNO2/c1-9-2-7-13(19)15-12(8-14(21)22)17(20-16(9)15)10-3-5-11(18)6-4-10/h2-7,20H,8H2,1H3,(H,21,22) |
| InChIKey | AEULRCRMHPIMIC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |