C17H13Cl2NO2 — CID 5138090
2-[4,6-dichloro-2-(4-methylphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 5138090) has the molecular formula C17H13Cl2NO2 and a molecular weight of 334.20 g/mol. Its IUPAC name is 2-[4,6-dichloro-2-(4-methylphenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[4,6-dichloro-2-(4-methylphenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 5138090 |
| Molecular Formula | C17H13Cl2NO2 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 2-[4,6-dichloro-2-(4-methylphenyl)-1H-indol-3-yl]acetic acid |
| SMILES | Cc1ccc(-c2[nH]c3cc(Cl)cc(Cl)c3c2CC(=O)O)cc1 |
| InChI | InChI=1S/C17H13Cl2NO2/c1-9-2-4-10(5-3-9)17-12(8-15(21)22)16-13(19)6-11(18)7-14(16)20-17/h2-7,20H,8H2,1H3,(H,21,22) |
| InChIKey | HYAXFZXSRMFOIQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |