C19H20Cl2N2 — CID 3919387
4-[4,6-dichloro-2-(4-methylphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3919387) has the molecular formula C19H20Cl2N2 and a molecular weight of 347.29 g/mol. Its IUPAC name is 4-[4,6-dichloro-2-(4-methylphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[4,6-dichloro-2-(4-methylphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3919387 |
| Molecular Formula | C19H20Cl2N2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-[4,6-dichloro-2-(4-methylphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc(-c2[nH]c3cc(Cl)cc(Cl)c3c2CCCCN)cc1 |
| InChI | InChI=1S/C19H20Cl2N2/c1-12-5-7-13(8-6-12)19-15(4-2-3-9-22)18-16(21)10-14(20)11-17(18)23-19/h5-8,10-11,23H,2-4,9,22H2,1H3 |
| InChIKey | QFYGUCHJWHZRSS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|