C20H22Cl2N2 — CID 5183042
4-[4,6-dichloro-2-(2,4-dimethylphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 5183042) has the molecular formula C20H22Cl2N2 and a molecular weight of 361.32 g/mol. Its IUPAC name is 4-[4,6-dichloro-2-(2,4-dimethylphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[4,6-dichloro-2-(2,4-dimethylphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 5183042 |
| Molecular Formula | C20H22Cl2N2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 4-[4,6-dichloro-2-(2,4-dimethylphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc(-c2[nH]c3cc(Cl)cc(Cl)c3c2CCCCN)c(C)c1 |
| InChI | InChI=1S/C20H22Cl2N2/c1-12-6-7-15(13(2)9-12)20-16(5-3-4-8-23)19-17(22)10-14(21)11-18(19)24-20/h6-7,9-11,24H,3-5,8,23H2,1-2H3 |
| InChIKey | FUDLEPFURQQBSZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|