About 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine
4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3449865) has the molecular formula C23H23Cl2N3O
and a molecular weight of 428.36 g/mol. Its IUPAC name is 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine.
Molecular Properties
| Compound Name | 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine |
| PubChem CID | 3449865 |
| Molecular Formula | C23H23Cl2N3O |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1ccc(-c2[nH]c3cc(Cl)cc(Cl)c3c2CCCCN)c2ccc(C)nc12 |
| InChI | InChI=1S/C23H23Cl2N3O/c1-13-6-7-16-15(8-9-20(29-2)23(16)27-13)22-17(5-3-4-10-26)21-18(25)11-14(24)12-19(21)28-22/h6-9,11-12,28H,3-5,10,26H2,1-2H3 |
| InChIKey | FICJZYXJFUFSPE-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine?
The IUPAC name of 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine (CID 3449865) is 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine.
What is the SMILES notation for 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine?
The canonical SMILES for 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine is COc1ccc(-c2[nH]c3cc(Cl)cc(Cl)c3c2CCCCN)c2ccc(C)nc12.
What is the InChIKey of 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine?
The InChIKey is FICJZYXJFUFSPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23Cl2N3O/c1-13-6-7-16-15(8-9-20(29-2)23(16)27-13)22-17(5-3-4-10-26)21-18(25)11-14(24)12-19(21)28-22/h6-9,11-12,28H,3-5,10,26H2,1-2H3.
What are the key properties of 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine?
4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine has a molecular weight of 428.36 g/mol, XLogP of 6.29, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4,6-dichloro-2-(8-methoxy-2-methylquinolin-5-yl)-1H-indol-3-yl]butan-1-amine is sourced from PubChem (CID 3449865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).