C17H18Cl2N2S — CID 4537294
4-[4,6-dichloro-2-(5-methylthiophen-2-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4537294) has the molecular formula C17H18Cl2N2S and a molecular weight of 353.32 g/mol. Its IUPAC name is 4-[4,6-dichloro-2-(5-methylthiophen-2-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[4,6-dichloro-2-(5-methylthiophen-2-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4537294 |
| Molecular Formula | C17H18Cl2N2S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 4-[4,6-dichloro-2-(5-methylthiophen-2-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | Cc1ccc(-c2[nH]c3cc(Cl)cc(Cl)c3c2CCCCN)s1 |
| InChI | InChI=1S/C17H18Cl2N2S/c1-10-5-6-15(22-10)17-12(4-2-3-7-20)16-13(19)8-11(18)9-14(16)21-17/h5-6,8-9,21H,2-4,7,20H2,1H3 |
| InChIKey | BZGVJAYQZRYSLI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|