C20H22Cl2N2O2 — CID 4641134
4-[4,6-dichloro-2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4641134) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is 4-[4,6-dichloro-2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[4,6-dichloro-2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4641134 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-[4,6-dichloro-2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1ccc(OC)c(-c2[nH]c3cc(Cl)cc(Cl)c3c2CCCCN)c1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-25-13-6-7-18(26-2)15(11-13)20-14(5-3-4-8-23)19-16(22)9-12(21)10-17(19)24-20/h6-7,9-11,24H,3-5,8,23H2,1-2H3 |
| InChIKey | CACIYGXERBBPGB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|