C23H29ClN2O — CID 5243590
4-[5-tert-butyl-2-(5-chloro-2-methoxyphenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 5243590) has the molecular formula C23H29ClN2O and a molecular weight of 384.95 g/mol. Its IUPAC name is 4-[5-tert-butyl-2-(5-chloro-2-methoxyphenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-tert-butyl-2-(5-chloro-2-methoxyphenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 5243590 |
| Molecular Formula | C23H29ClN2O |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[5-tert-butyl-2-(5-chloro-2-methoxyphenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1ccc(Cl)cc1-c1[nH]c2ccc(C(C)(C)C)cc2c1CCCCN |
| InChI | InChI=1S/C23H29ClN2O/c1-23(2,3)15-8-10-20-18(13-15)17(7-5-6-12-25)22(26-20)19-14-16(24)9-11-21(19)27-4/h8-11,13-14,26H,5-7,12,25H2,1-4H3 |
| InChIKey | ZGJFQWHVLRBABN-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|