C25H25ClN2O2 — CID 3539638
4-[2-(5-chloro-2-methoxyphenyl)-5-phenoxy-1H-indol-3-yl]butan-1-amine (PubChem CID 3539638) has the molecular formula C25H25ClN2O2 and a molecular weight of 420.94 g/mol. Its IUPAC name is 4-[2-(5-chloro-2-methoxyphenyl)-5-phenoxy-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(5-chloro-2-methoxyphenyl)-5-phenoxy-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3539638 |
| Molecular Formula | C25H25ClN2O2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 4-[2-(5-chloro-2-methoxyphenyl)-5-phenoxy-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1ccc(Cl)cc1-c1[nH]c2ccc(Oc3ccccc3)cc2c1CCCCN |
| InChI | InChI=1S/C25H25ClN2O2/c1-29-24-13-10-17(26)15-22(24)25-20(9-5-6-14-27)21-16-19(11-12-23(21)28-25)30-18-7-3-2-4-8-18/h2-4,7-8,10-13,15-16,28H,5-6,9,14,27H2,1H3 |
| InChIKey | UZYJSNMPRGALSE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|