C25H22ClF3N2O — CID 3291203
4-[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-phenoxy-1H-indol-3-yl]butan-1-amine (PubChem CID 3291203) has the molecular formula C25H22ClF3N2O and a molecular weight of 458.91 g/mol. Its IUPAC name is 4-[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-phenoxy-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-phenoxy-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3291203 |
| Molecular Formula | C25H22ClF3N2O |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 4-[2-[2-chloro-5-(trifluoromethyl)phenyl]-5-phenoxy-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2cc(C(F)(F)F)ccc2Cl)[nH]c2ccc(Oc3ccccc3)cc12 |
| InChI | InChI=1S/C25H22ClF3N2O/c26-22-11-9-16(25(27,28)29)14-21(22)24-19(8-4-5-13-30)20-15-18(10-12-23(20)31-24)32-17-6-2-1-3-7-17/h1-3,6-7,9-12,14-15,31H,4-5,8,13,30H2 |
| InChIKey | VGCDXXPDHGIHJV-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|