C19H18F3IN2O — CID 3472780
4-[2-(2-iodophenyl)-5-(trifluoromethoxy)-1H-indol-3-yl]butan-1-amine (PubChem CID 3472780) has the molecular formula C19H18F3IN2O and a molecular weight of 474.26 g/mol. Its IUPAC name is 4-[2-(2-iodophenyl)-5-(trifluoromethoxy)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(2-iodophenyl)-5-(trifluoromethoxy)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3472780 |
| Molecular Formula | C19H18F3IN2O |
| Molecular Weight | 474.26 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 4-[2-(2-iodophenyl)-5-(trifluoromethoxy)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccccc2I)[nH]c2ccc(OC(F)(F)F)cc12 |
| InChI | InChI=1S/C19H18F3IN2O/c20-19(21,22)26-12-8-9-17-15(11-12)13(5-3-4-10-24)18(25-17)14-6-1-2-7-16(14)23/h1-2,6-9,11,25H,3-5,10,24H2 |
| InChIKey | UKWUQTFITIAFMF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.26 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|