C23H22F3N3O2 — CID 4543736
4-[2-(4-methoxyquinolin-2-yl)-5-(trifluoromethoxy)-1H-indol-3-yl]butan-1-amine (PubChem CID 4543736) has the molecular formula C23H22F3N3O2 and a molecular weight of 429.44 g/mol. Its IUPAC name is 4-[2-(4-methoxyquinolin-2-yl)-5-(trifluoromethoxy)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(4-methoxyquinolin-2-yl)-5-(trifluoromethoxy)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4543736 |
| Molecular Formula | C23H22F3N3O2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 4-[2-(4-methoxyquinolin-2-yl)-5-(trifluoromethoxy)-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1cc(-c2[nH]c3ccc(OC(F)(F)F)cc3c2CCCCN)nc2ccccc12 |
| InChI | InChI=1S/C23H22F3N3O2/c1-30-21-13-20(28-18-8-3-2-7-16(18)21)22-15(6-4-5-11-27)17-12-14(31-23(24,25)26)9-10-19(17)29-22/h2-3,7-10,12-13,29H,4-6,11,27H2,1H3 |
| InChIKey | ZJFCILSPVRHDBA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|