C21H23N3S — CID 3984234
4-[2-(1,3-benzothiazol-2-yl)-5-ethyl-1H-indol-3-yl]butan-1-amine (PubChem CID 3984234) has the molecular formula C21H23N3S and a molecular weight of 349.50 g/mol. Its IUPAC name is 4-[2-(1,3-benzothiazol-2-yl)-5-ethyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[2-(1,3-benzothiazol-2-yl)-5-ethyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3984234 |
| Molecular Formula | C21H23N3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 4-[2-(1,3-benzothiazol-2-yl)-5-ethyl-1H-indol-3-yl]butan-1-amine |
| SMILES | CCc1ccc2[nH]c(-c3nc4ccccc4s3)c(CCCCN)c2c1 |
| InChI | InChI=1S/C21H23N3S/c1-2-14-10-11-17-16(13-14)15(7-5-6-12-22)20(23-17)21-24-18-8-3-4-9-19(18)25-21/h3-4,8-11,13,23H,2,5-7,12,22H2,1H3 |
| InChIKey | YPXGHGCTWIDPLW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|