C27H32N2 — CID 5010457
4-[5-butyl-2-(4-methylnaphthalen-1-yl)-1H-indol-3-yl]butan-1-amine (PubChem CID 5010457) has the molecular formula C27H32N2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 4-[5-butyl-2-(4-methylnaphthalen-1-yl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-butyl-2-(4-methylnaphthalen-1-yl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 5010457 |
| Molecular Formula | C27H32N2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 4-[5-butyl-2-(4-methylnaphthalen-1-yl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCCCc1ccc2[nH]c(-c3ccc(C)c4ccccc34)c(CCCCN)c2c1 |
| InChI | InChI=1S/C27H32N2/c1-3-4-9-20-14-16-26-25(18-20)23(12-7-8-17-28)27(29-26)24-15-13-19(2)21-10-5-6-11-22(21)24/h5-6,10-11,13-16,18,29H,3-4,7-9,12,17,28H2,1-2H3 |
| InChIKey | PAWMMWCLVOCKTQ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|