C22H26Cl2N2 — CID 3644424
4-[5-butyl-2-(3,4-dichlorophenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3644424) has the molecular formula C22H26Cl2N2 and a molecular weight of 389.37 g/mol. Its IUPAC name is 4-[5-butyl-2-(3,4-dichlorophenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-butyl-2-(3,4-dichlorophenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3644424 |
| Molecular Formula | C22H26Cl2N2 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-[5-butyl-2-(3,4-dichlorophenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCCCc1ccc2[nH]c(-c3ccc(Cl)c(Cl)c3)c(CCCCN)c2c1 |
| InChI | InChI=1S/C22H26Cl2N2/c1-2-3-6-15-8-11-21-18(13-15)17(7-4-5-12-25)22(26-21)16-9-10-19(23)20(24)14-16/h8-11,13-14,26H,2-7,12,25H2,1H3 |
| InChIKey | DZPTVINDIHSGKU-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|