C22H27ClN2 — CID 3340482
4-[5-butyl-2-(3-chlorophenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 3340482) has the molecular formula C22H27ClN2 and a molecular weight of 354.93 g/mol. Its IUPAC name is 4-[5-butyl-2-(3-chlorophenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-butyl-2-(3-chlorophenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3340482 |
| Molecular Formula | C22H27ClN2 |
| Molecular Weight | 354.93 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 4-[5-butyl-2-(3-chlorophenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | CCCCc1ccc2[nH]c(-c3cccc(Cl)c3)c(CCCCN)c2c1 |
| InChI | InChI=1S/C22H27ClN2/c1-2-3-7-16-11-12-21-20(14-16)19(10-4-5-13-24)22(25-21)17-8-6-9-18(23)15-17/h6,8-9,11-12,14-15,25H,2-5,7,10,13,24H2,1H3 |
| InChIKey | LRIMJZVYMVYFSI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.93 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|