C18H17BrCl2N2 — CID 4039818
4-[5-bromo-2-(3,4-dichlorophenyl)-1H-indol-3-yl]butan-1-amine (PubChem CID 4039818) has the molecular formula C18H17BrCl2N2 and a molecular weight of 412.16 g/mol. Its IUPAC name is 4-[5-bromo-2-(3,4-dichlorophenyl)-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[5-bromo-2-(3,4-dichlorophenyl)-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 4039818 |
| Molecular Formula | C18H17BrCl2N2 |
| Molecular Weight | 412.16 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 4-[5-bromo-2-(3,4-dichlorophenyl)-1H-indol-3-yl]butan-1-amine |
| SMILES | NCCCCc1c(-c2ccc(Cl)c(Cl)c2)[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C18H17BrCl2N2/c19-12-5-7-17-14(10-12)13(3-1-2-8-22)18(23-17)11-4-6-15(20)16(21)9-11/h4-7,9-10,23H,1-3,8,22H2 |
| InChIKey | AOHFPNGHNMDSAX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.16 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|