C21H24N2O4 — CID 3934943
3-(4-aminobutyl)-2-(2,6-dimethoxyphenyl)-1H-indole-5-carboxylic acid (PubChem CID 3934943) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(2,6-dimethoxyphenyl)-1H-indole-5-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-2-(2,6-dimethoxyphenyl)-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 3934943 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-(4-aminobutyl)-2-(2,6-dimethoxyphenyl)-1H-indole-5-carboxylic acid |
| SMILES | COc1cccc(OC)c1-c1[nH]c2ccc(C(=O)O)cc2c1CCCCN |
| InChI | InChI=1S/C21H24N2O4/c1-26-17-7-5-8-18(27-2)19(17)20-14(6-3-4-11-22)15-12-13(21(24)25)9-10-16(15)23-20/h5,7-10,12,23H,3-4,6,11,22H2,1-2H3,(H,24,25) |
| InChIKey | BNEVYMNJJIFXSW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|