C19H20N2O2 — CID 21249903
3-(2-aminoethyl)-2-(3,5-dimethylphenyl)-1H-indole-5-carboxylic acid (PubChem CID 21249903) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-(2-aminoethyl)-2-(3,5-dimethylphenyl)-1H-indole-5-carboxylic acid.
| Compound Name | 3-(2-aminoethyl)-2-(3,5-dimethylphenyl)-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 21249903 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 3-(2-aminoethyl)-2-(3,5-dimethylphenyl)-1H-indole-5-carboxylic acid |
| SMILES | Cc1cc(C)cc(-c2[nH]c3ccc(C(=O)O)cc3c2CCN)c1 |
| InChI | InChI=1S/C19H20N2O2/c1-11-7-12(2)9-14(8-11)18-15(5-6-20)16-10-13(19(22)23)3-4-17(16)21-18/h3-4,7-10,21H,5-6,20H2,1-2H3,(H,22,23) |
| InChIKey | RNJBCKNEQGNOHA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |