C22H25NO — CID 57005944
2-[2-(3,5-dimethylphenyl)-3-ethyl-1H-indol-5-yl]-2-methylpropanal (PubChem CID 57005944) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylphenyl)-3-ethyl-1H-indol-5-yl]-2-methylpropanal.
| Compound Name | 2-[2-(3,5-dimethylphenyl)-3-ethyl-1H-indol-5-yl]-2-methylpropanal |
|---|---|
| PubChem CID | 57005944 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-[2-(3,5-dimethylphenyl)-3-ethyl-1H-indol-5-yl]-2-methylpropanal |
| SMILES | CCc1c(-c2cc(C)cc(C)c2)[nH]c2ccc(C(C)(C)C=O)cc12 |
| InChI | InChI=1S/C22H25NO/c1-6-18-19-12-17(22(4,5)13-24)7-8-20(19)23-21(18)16-10-14(2)9-15(3)11-16/h7-13,23H,6H2,1-5H3 |
| InChIKey | NUXLTVPURSPKGQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|