C19H18Cl2N2O2 — CID 3450980
3-(4-aminobutyl)-2-(2,6-dichlorophenyl)-1H-indole-5-carboxylic acid (PubChem CID 3450980) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(2,6-dichlorophenyl)-1H-indole-5-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-2-(2,6-dichlorophenyl)-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 3450980 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 3-(4-aminobutyl)-2-(2,6-dichlorophenyl)-1H-indole-5-carboxylic acid |
| SMILES | NCCCCc1c(-c2c(Cl)cccc2Cl)[nH]c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C19H18Cl2N2O2/c20-14-5-3-6-15(21)17(14)18-12(4-1-2-9-22)13-10-11(19(24)25)7-8-16(13)23-18/h3,5-8,10,23H,1-2,4,9,22H2,(H,24,25) |
| InChIKey | DTZZSLWBFZPHCD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|