C18H20N2O2S — CID 3929624
2-[3-(4-aminobutyl)-2-thiophen-2-yl-1H-indol-5-yl]acetic acid (PubChem CID 3929624) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 2-[3-(4-aminobutyl)-2-thiophen-2-yl-1H-indol-5-yl]acetic acid.
| Compound Name | 2-[3-(4-aminobutyl)-2-thiophen-2-yl-1H-indol-5-yl]acetic acid |
|---|---|
| PubChem CID | 3929624 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[3-(4-aminobutyl)-2-thiophen-2-yl-1H-indol-5-yl]acetic acid |
| SMILES | NCCCCc1c(-c2cccs2)[nH]c2ccc(CC(=O)O)cc12 |
| InChI | InChI=1S/C18H20N2O2S/c19-8-2-1-4-13-14-10-12(11-17(21)22)6-7-15(14)20-18(13)16-5-3-9-23-16/h3,5-7,9-10,20H,1-2,4,8,11,19H2,(H,21,22) |
| InChIKey | OEMYZRBWTQDBCN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|