C19H19BrN2O2 — CID 3883431
3-(4-aminobutyl)-2-(2-bromophenyl)-1H-indole-5-carboxylic acid (PubChem CID 3883431) has the molecular formula C19H19BrN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is 3-(4-aminobutyl)-2-(2-bromophenyl)-1H-indole-5-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-2-(2-bromophenyl)-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 3883431 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3-(4-aminobutyl)-2-(2-bromophenyl)-1H-indole-5-carboxylic acid |
| SMILES | NCCCCc1c(-c2ccccc2Br)[nH]c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C19H19BrN2O2/c20-16-7-2-1-6-14(16)18-13(5-3-4-10-21)15-11-12(19(23)24)8-9-17(15)22-18/h1-2,6-9,11,22H,3-5,10,21H2,(H,23,24) |
| InChIKey | RIYHMYANNXUNNJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|